C15H18O7 — CID 101375971
(E)-3-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoic acid (PubChem CID 101375971) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (E)-3-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 101375971 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (E)-3-[4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1O[C@@H](Oc2ccc(/C=C/C(=O)O)cc2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H18O7/c1-8-12(18)13(19)14(20)15(21-8)22-10-5-2-9(3-6-10)4-7-11(16)17/h2-8,12-15,18-20H,1H3,(H,16,17)/b7-4+/t8-,12-,13+,14+,15-/m0/s1 |
| InChIKey | PJUPSUOGZDXPRP-UVHWXNHCSA-N |
| XLogP | -0.01 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|