C23H31NO7 — CID 162884613
2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enoate (PubChem CID 162884613) has the molecular formula C23H31NO7 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enoate.
| Compound Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162884613 |
| Molecular Formula | C23H31NO7 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylmethyl 3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enoate |
| SMILES | CC1OC(Oc2ccc(C=CC(=O)OCC3CCN4CCCC34)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C23H31NO7/c1-14-20(26)21(27)22(28)23(30-14)31-17-7-4-15(5-8-17)6-9-19(25)29-13-16-10-12-24-11-2-3-18(16)24/h4-9,14,16,18,20-23,26-28H,2-3,10-13H2,1H3 |
| InChIKey | NZLSLVIWDCNZHH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|