C25H35NO8 — CID 162941671
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate (PubChem CID 162941671) has the molecular formula C25H35NO8 and a molecular weight of 477.55 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 162941671 |
| Molecular Formula | C25H35NO8 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl 3-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1)OCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C25H35NO8/c27-14-20-22(29)23(30)24(31)25(34-20)33-18-9-6-16(7-10-18)8-11-21(28)32-15-17-4-3-13-26-12-2-1-5-19(17)26/h6-11,17,19-20,22-25,27,29-31H,1-5,12-15H2 |
| InChIKey | QAHMZPNJFDXXEL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|