C25H35NO7 — CID 163188805
[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoate (PubChem CID 163188805) has the molecular formula C25H35NO7 and a molecular weight of 461.56 g/mol. Its IUPAC name is [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoate.
| Compound Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 163188805 |
| Molecular Formula | C25H35NO7 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | [(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]prop-2-enoate |
| SMILES | C[C@H]1O[C@H](Oc2ccc(/C=C/C(=O)OC[C@H]3CCCN4CCCC[C@H]34)cc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H35NO7/c1-16-22(28)23(29)24(30)25(32-16)33-19-10-7-17(8-11-19)9-12-21(27)31-15-18-5-4-14-26-13-3-2-6-20(18)26/h7-12,16,18,20,22-25,28-30H,2-6,13-15H2,1H3/b12-9+/t16-,18-,20-,22-,23+,24+,25-/m1/s1 |
| InChIKey | AVJNWBOJPTXAPF-IYDXFIHGSA-N |
| XLogP | 1.71 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|