C26H31NO2 — CID 171146657
[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 3-methyl-5-naphthalen-2-ylpenta-2,4-dienoate (PubChem CID 171146657) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 3-methyl-5-naphthalen-2-ylpenta-2,4-dienoate.
| Compound Name | [(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 3-methyl-5-naphthalen-2-ylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 171146657 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | [(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 3-methyl-5-naphthalen-2-ylpenta-2,4-dienoate |
| SMILES | CC(C=Cc1ccc2ccccc2c1)=CC(=O)OC[C@H]1CCCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C26H31NO2/c1-20(11-12-21-13-14-22-7-2-3-8-23(22)18-21)17-26(28)29-19-24-9-6-16-27-15-5-4-10-25(24)27/h2-3,7-8,11-14,17-18,24-25H,4-6,9-10,15-16,19H2,1H3/t24-,25+/m1/s1 |
| InChIKey | IGDFWKVJPRWUFQ-RPBOFIJWSA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|