C19H25NO3 — CID 6430133
[(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 6430133) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is [(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6430133 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | [(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1CCCN2CCCCC12 |
| InChI | InChI=1S/C19H25NO3/c21-17-9-6-15(7-10-17)8-11-19(22)23-14-16-4-3-13-20-12-2-1-5-18(16)20/h6-11,16,18,21H,1-5,12-14H2/b11-8+/t16-,18?/m1/s1 |
| InChIKey | IZIOGYPZZKPZLM-RZCWYNRPSA-N |
| XLogP | 3.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|