C17H24N2O — CID 135869196
4-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]phenol (PubChem CID 135869196) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]phenol.
| Compound Name | 4-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]phenol |
|---|---|
| PubChem CID | 135869196 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyliminomethyl]phenol |
| SMILES | Oc1ccc(/C=N/C[C@H]2CCCN3CCCC[C@@H]23)cc1 |
| InChI | InChI=1S/C17H24N2O/c20-16-8-6-14(7-9-16)12-18-13-15-4-3-11-19-10-2-1-5-17(15)19/h6-9,12,15,17,20H,1-5,10-11,13H2/b18-12+/t15-,17+/m1/s1 |
| InChIKey | CQQPHVVCNFQDKX-YYXRTCSZSA-N |
| XLogP | 3.08 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|