C23H29N — CID 53304968
(1S,9aR)-1-(2,2-diphenylethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 53304968) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is (1S,9aR)-1-(2,2-diphenylethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1S,9aR)-1-(2,2-diphenylethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 53304968 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (1S,9aR)-1-(2,2-diphenylethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | c1ccc(C(C[C@@H]2CCCN3CCCC[C@H]23)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29N/c1-3-10-19(11-4-1)22(20-12-5-2-6-13-20)18-21-14-9-17-24-16-8-7-15-23(21)24/h1-6,10-13,21-23H,7-9,14-18H2/t21-,23+/m0/s1 |
| InChIKey | HOCOGSQQTMYEBM-JTHBVZDNSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |