C21H32N2O3 — CID 72940889
3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]propanamide (PubChem CID 72940889) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]propanamide.
| Compound Name | 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]propanamide |
|---|---|
| PubChem CID | 72940889 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]propanamide |
| SMILES | O=C(CC[C@@H]1CCCN2CCCC[C@H]12)N[C@@H](CO)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O3/c24-15-18(21(26)17-7-2-1-3-8-17)22-20(25)12-11-16-9-6-14-23-13-5-4-10-19(16)23/h1-3,7-8,16,18-19,21,24,26H,4-6,9-15H2,(H,22,25)/t16-,18-,19+,21-/m0/s1 |
| InChIKey | AAUCASRZVZJRIY-ROPHOZQPSA-N |
| XLogP | 2.24 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |