C20H27BrN2O3 — CID 11553591
N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-6-pyridin-1-ium-1-ylhexanamide bromide (PubChem CID 11553591) has the molecular formula C20H27BrN2O3 and a molecular weight of 423.35 g/mol. Its IUPAC name is N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-6-pyridin-1-ium-1-ylhexanamide bromide.
| Compound Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-6-pyridin-1-ium-1-ylhexanamide bromide |
|---|---|
| PubChem CID | 11553591 |
| Molecular Formula | C20H27BrN2O3 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[(1S,2S)-1,3-dihydroxy-1-phenylpropan-2-yl]-6-pyridin-1-ium-1-ylhexanamide bromide |
| SMILES | O=C(CCCCC[n+]1ccccc1)N[C@@H](CO)[C@@H](O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C20H26N2O3.BrH/c23-16-18(20(25)17-10-4-1-5-11-17)21-19(24)12-6-2-7-13-22-14-8-3-9-15-22;/h1,3-5,8-11,14-15,18,20,23,25H,2,6-7,12-13,16H2;1H/t18-,20-;/m0./s1 |
| InChIKey | HSTIPAMNEQDVQC-MKSBGGEFSA-N |
| XLogP | -1.25 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|