C15H25N2O+ — CID 67882668
N-(2-methylpropyl)-6-pyridin-1-ium-1-ylhexanamide (PubChem CID 67882668) has the molecular formula C15H25N2O+ and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(2-methylpropyl)-6-pyridin-1-ium-1-ylhexanamide.
| Compound Name | N-(2-methylpropyl)-6-pyridin-1-ium-1-ylhexanamide |
|---|---|
| PubChem CID | 67882668 |
| Molecular Formula | C15H25N2O+ |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | N-(2-methylpropyl)-6-pyridin-1-ium-1-ylhexanamide |
| SMILES | CC(C)CNC(=O)CCCCC[n+]1ccccc1 |
| InChI | InChI=1S/C15H24N2O/c1-14(2)13-16-15(18)9-5-3-6-10-17-11-7-4-8-12-17/h4,7-8,11-12,14H,3,5-6,9-10,13H2,1-2H3/p+1 |
| InChIKey | BFBXIXJCDPDJPC-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|