C34H60N3O4+ — CID 102223387
ethyl (2S)-6-(decanoylamino)-2-(11-pyridin-1-ium-1-ylundecanoylamino)hexanoate (PubChem CID 102223387) has the molecular formula C34H60N3O4+ and a molecular weight of 574.87 g/mol. Its IUPAC name is ethyl (2S)-6-(decanoylamino)-2-(11-pyridin-1-ium-1-ylundecanoylamino)hexanoate.
| Compound Name | ethyl (2S)-6-(decanoylamino)-2-(11-pyridin-1-ium-1-ylundecanoylamino)hexanoate |
|---|---|
| PubChem CID | 102223387 |
| Molecular Formula | C34H60N3O4+ |
| Molecular Weight | 574.87 g/mol |
| Exact Mass | 574.46 |
| IUPAC Name | ethyl (2S)-6-(decanoylamino)-2-(11-pyridin-1-ium-1-ylundecanoylamino)hexanoate |
| SMILES | CCCCCCCCCC(=O)NCCCC[C@H](NC(=O)CCCCCCCCCC[n+]1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C34H59N3O4/c1-3-5-6-7-10-13-17-25-32(38)35-27-20-19-24-31(34(40)41-4-2)36-33(39)26-18-14-11-8-9-12-15-21-28-37-29-22-16-23-30-37/h16,22-23,29-31H,3-15,17-21,24-28H2,1-2H3,(H-,35,36,38,39)/p+1/t31-/m0/s1 |
| InChIKey | GJCDNSKBIHNSMY-HKBQPEDESA-O |
| XLogP | 6.96 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.87 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|