C19H37N3O3 — CID 155445276
N-(2-methylpropyl)-N'-[2-oxo-2-(propan-2-ylamino)ethyl]decanediamide (PubChem CID 155445276) has the molecular formula C19H37N3O3 and a molecular weight of 355.52 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-[2-oxo-2-(propan-2-ylamino)ethyl]decanediamide.
| Compound Name | N-(2-methylpropyl)-N'-[2-oxo-2-(propan-2-ylamino)ethyl]decanediamide |
|---|---|
| PubChem CID | 155445276 |
| Molecular Formula | C19H37N3O3 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | N-(2-methylpropyl)-N'-[2-oxo-2-(propan-2-ylamino)ethyl]decanediamide |
| SMILES | CC(C)CNC(=O)CCCCCCCCC(=O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C19H37N3O3/c1-15(2)13-20-17(23)11-9-7-5-6-8-10-12-18(24)21-14-19(25)22-16(3)4/h15-16H,5-14H2,1-4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | QVCYVWSRUBBAIP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|