C19H29N3O2 — CID 119063763
3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[2-(6-oxo-1H-pyridin-2-yl)ethyl]propanamide (PubChem CID 119063763) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[2-(6-oxo-1H-pyridin-2-yl)ethyl]propanamide.
| Compound Name | 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[2-(6-oxo-1H-pyridin-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 119063763 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-[2-(6-oxo-1H-pyridin-2-yl)ethyl]propanamide |
| SMILES | O=C(CC[C@@H]1CCCN2CCCC[C@H]12)NCCc1cccc(=O)[nH]1 |
| InChI | InChI=1S/C19H29N3O2/c23-18(20-12-11-16-6-3-8-19(24)21-16)10-9-15-5-4-14-22-13-2-1-7-17(15)22/h3,6,8,15,17H,1-2,4-5,7,9-14H2,(H,20,23)(H,21,24)/t15-,17+/m0/s1 |
| InChIKey | YGDGJQMVNCXPIZ-DOTOQJQBSA-N |
| XLogP | 2.08 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |