C17H29NO4 — CID 11874133
6-O-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl] 1-O-methyl hexanedioate (PubChem CID 11874133) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 6-O-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl] 1-O-methyl hexanedioate.
| Compound Name | 6-O-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl] 1-O-methyl hexanedioate |
|---|---|
| PubChem CID | 11874133 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 6-O-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl] 1-O-methyl hexanedioate |
| SMILES | COC(=O)CCCCC(=O)OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C17H29NO4/c1-21-16(19)9-2-3-10-17(20)22-13-14-7-6-12-18-11-5-4-8-15(14)18/h14-15H,2-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | YEJYJMJSSKKYGP-LSDHHAIUSA-N |
| XLogP | 2.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|