C14H25NO2 — CID 3718427
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl butanoate (PubChem CID 3718427) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl butanoate.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl butanoate |
|---|---|
| PubChem CID | 3718427 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl butanoate |
| SMILES | CCCC(=O)OCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C14H25NO2/c1-2-6-14(16)17-11-12-7-5-10-15-9-4-3-8-13(12)15/h12-13H,2-11H2,1H3 |
| InChIKey | CWMGUIJYDGBJPZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |