C13H23NO3 — CID 6541326
[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-methoxyacetate (PubChem CID 6541326) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-methoxyacetate.
| Compound Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 6541326 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-methoxyacetate |
| SMILES | COCC(=O)OC[C@@H]1CCCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H23NO3/c1-16-10-13(15)17-9-11-5-4-8-14-7-3-2-6-12(11)14/h11-12H,2-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | HFNRVGNQFRTRRF-RYUDHWBXSA-N |
| XLogP | 1.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |