C17H32ClNO2 — CID 52993527
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl heptanoate;hydrochloride (PubChem CID 52993527) has the molecular formula C17H32ClNO2 and a molecular weight of 317.90 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl heptanoate;hydrochloride.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl heptanoate;hydrochloride |
|---|---|
| PubChem CID | 52993527 |
| Molecular Formula | C17H32ClNO2 |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl heptanoate;hydrochloride |
| SMILES | CCCCCCC(=O)OC[C@@H]1CCCN2CCCC[C@H]12.Cl |
| InChI | InChI=1S/C17H31NO2.ClH/c1-2-3-4-5-11-17(19)20-14-15-9-8-13-18-12-7-6-10-16(15)18;/h15-16H,2-14H2,1H3;1H/t15-,16+;/m0./s1 |
| InChIKey | RDHUPXJFQVLPIJ-IDVLALEDSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|