C14H24ClNO2 — CID 11873269
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (2S)-2-chlorobutanoate (PubChem CID 11873269) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (2S)-2-chlorobutanoate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (2S)-2-chlorobutanoate |
|---|---|
| PubChem CID | 11873269 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl (2S)-2-chlorobutanoate |
| SMILES | CC[C@H](Cl)C(=O)OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C14H24ClNO2/c1-2-12(15)14(17)18-10-11-6-5-9-16-8-4-3-7-13(11)16/h11-13H,2-10H2,1H3/t11-,12-,13+/m0/s1 |
| InChIKey | RMBGDEJIZNNLOF-RWMBFGLXSA-N |
| XLogP | 2.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|