C19H26ClNO3 — CID 10906753
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenoxy)propanoate (PubChem CID 10906753) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenoxy)propanoate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 10906753 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C19H26ClNO3/c1-14(24-17-9-7-16(20)8-10-17)19(22)23-13-15-5-4-12-21-11-3-2-6-18(15)21/h7-10,14-15,18H,2-6,11-13H2,1H3/t14?,15-,18+/m0/s1 |
| InChIKey | IABBAELMPGHNQF-JGNLYWJMSA-N |
| XLogP | 3.91 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |