C19H26ClNO2S — CID 11003112
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 11003112) has the molecular formula C19H26ClNO2S and a molecular weight of 367.94 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 11003112 |
| Molecular Formula | C19H26ClNO2S |
| Molecular Weight | 367.94 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)OC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C19H26ClNO2S/c1-14(24-17-9-7-16(20)8-10-17)19(22)23-13-15-5-4-12-21-11-3-2-6-18(15)21/h7-10,14-15,18H,2-6,11-13H2,1H3/t14?,15-,18+/m0/s1 |
| InChIKey | NDXIEKXWGWSJOJ-JGNLYWJMSA-N |
| XLogP | 4.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |