C17H23NO3 — CID 11915168
[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-hydroxybenzoate (PubChem CID 11915168) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-hydroxybenzoate.
| Compound Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 11915168 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-hydroxybenzoate |
| SMILES | O=C(OC[C@@H]1CCCN2CCCC[C@H]12)c1ccccc1O |
| InChI | InChI=1S/C17H23NO3/c19-16-9-2-1-7-14(16)17(20)21-12-13-6-5-11-18-10-4-3-8-15(13)18/h1-2,7,9,13,15,19H,3-6,8,10-12H2/t13-,15+/m0/s1 |
| InChIKey | FPBZOZUALKCMGP-DZGCQCFKSA-N |
| XLogP | 2.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |