C22H27NO2 — CID 905125
[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-naphthalen-1-ylacetate (PubChem CID 905125) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-naphthalen-1-ylacetate.
| Compound Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 905125 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | [(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)OC[C@@H]1CCCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C22H27NO2/c24-22(15-18-9-5-8-17-7-1-2-11-20(17)18)25-16-19-10-6-14-23-13-4-3-12-21(19)23/h1-2,5,7-9,11,19,21H,3-4,6,10,12-16H2/t19-,21-/m0/s1 |
| InChIKey | QWMBISUDXDWQJQ-FPOVZHCZSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |