C22H27NO3 — CID 59981697
[(2S)-2-morpholin-4-ylcyclohexyl] 2-naphthalen-1-ylacetate (PubChem CID 59981697) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [(2S)-2-morpholin-4-ylcyclohexyl] 2-naphthalen-1-ylacetate.
| Compound Name | [(2S)-2-morpholin-4-ylcyclohexyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 59981697 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(2S)-2-morpholin-4-ylcyclohexyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)OC1CCCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C22H27NO3/c24-22(16-18-8-5-7-17-6-1-2-9-19(17)18)26-21-11-4-3-10-20(21)23-12-14-25-15-13-23/h1-2,5-9,20-21H,3-4,10-16H2/t20-,21?/m0/s1 |
| InChIKey | KCMVEXJEGVDMOY-BGERDNNASA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |