C20H27NO2S — CID 21045496
4-[(1R,2R)-2-[2-(1-benzothiophen-3-yl)ethoxy]cyclohexyl]morpholine (PubChem CID 21045496) has the molecular formula C20H27NO2S and a molecular weight of 345.51 g/mol. Its IUPAC name is 4-[(1R,2R)-2-[2-(1-benzothiophen-3-yl)ethoxy]cyclohexyl]morpholine.
| Compound Name | 4-[(1R,2R)-2-[2-(1-benzothiophen-3-yl)ethoxy]cyclohexyl]morpholine |
|---|---|
| PubChem CID | 21045496 |
| Molecular Formula | C20H27NO2S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 4-[(1R,2R)-2-[2-(1-benzothiophen-3-yl)ethoxy]cyclohexyl]morpholine |
| SMILES | c1ccc2c(CCO[C@@H]3CCCC[C@H]3N3CCOCC3)csc2c1 |
| InChI | InChI=1S/C20H27NO2S/c1-4-8-20-17(5-1)16(15-24-20)9-12-23-19-7-3-2-6-18(19)21-10-13-22-14-11-21/h1,4-5,8,15,18-19H,2-3,6-7,9-14H2/t18-,19-/m1/s1 |
| InChIKey | XMETTZAVKMMHKX-RTBURBONSA-N |
| XLogP | 4.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |