C21H29ClN2OS — CID 22418285
2-(1-benzothiophen-3-yl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide;hydrochloride (PubChem CID 22418285) has the molecular formula C21H29ClN2OS and a molecular weight of 393.00 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide;hydrochloride.
| Compound Name | 2-(1-benzothiophen-3-yl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 22418285 |
| Molecular Formula | C21H29ClN2OS |
| Molecular Weight | 393.00 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide;hydrochloride |
| SMILES | CN(C(=O)Cc1csc2ccccc12)C1CCCCC1N1CCCC1.Cl |
| InChI | InChI=1S/C21H28N2OS.ClH/c1-22(18-9-3-4-10-19(18)23-12-6-7-13-23)21(24)14-16-15-25-20-11-5-2-8-17(16)20;/h2,5,8,11,15,18-19H,3-4,6-7,9-10,12-14H2,1H3;1H |
| InChIKey | PXMNFXCFJWBAAR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |