C25H30N2O — CID 18637947
N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]-9H-fluorene-9-carboxamide (PubChem CID 18637947) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]-9H-fluorene-9-carboxamide.
| Compound Name | N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18637947 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-methyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]-9H-fluorene-9-carboxamide |
| SMILES | CN(C(=O)C1c2ccccc2-c2ccccc21)[C@@H]1CCCC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C25H30N2O/c1-26(22-14-6-7-15-23(22)27-16-8-9-17-27)25(28)24-20-12-4-2-10-18(20)19-11-3-5-13-21(19)24/h2-5,10-13,22-24H,6-9,14-17H2,1H3/t22-,23-/m1/s1 |
| InChIKey | FVLLJPBVZURRBJ-DHIUTWEWSA-N |
| XLogP | 4.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |