C19H27ClN2O — CID 14771377
2-(3-chlorophenyl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide (PubChem CID 14771377) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide.
| Compound Name | 2-(3-chlorophenyl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 14771377 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-(3-chlorophenyl)-N-methyl-N-(2-pyrrolidin-1-ylcyclohexyl)acetamide |
| SMILES | CN(C(=O)Cc1cccc(Cl)c1)C1CCCCC1N1CCCC1 |
| InChI | InChI=1S/C19H27ClN2O/c1-21(19(23)14-15-7-6-8-16(20)13-15)17-9-2-3-10-18(17)22-11-4-5-12-22/h6-8,13,17-18H,2-5,9-12,14H2,1H3 |
| InChIKey | WVFITRUKRNWDMA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |