C19H27N3O3 — CID 46878015
N-methyl-2-(4-nitrophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide (PubChem CID 46878015) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-methyl-2-(4-nitrophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide.
| Compound Name | N-methyl-2-(4-nitrophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 46878015 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-methyl-2-(4-nitrophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide |
| SMILES | CN(C(=O)Cc1ccc([N+](=O)[O-])cc1)[C@@H]1CCCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C19H27N3O3/c1-20(17-6-2-3-7-18(17)21-12-4-5-13-21)19(23)14-15-8-10-16(11-9-15)22(24)25/h8-11,17-18H,2-7,12-14H2,1H3/t17-,18+/m1/s1 |
| InChIKey | XFRBXJXHOVSGII-MSOLQXFVSA-N |
| XLogP | 3.00 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|