C20H29N5O — CID 21328053
2-(4-azidophenyl)-N-methyl-N-(2-piperidin-1-ylcyclohexyl)acetamide (PubChem CID 21328053) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-(4-azidophenyl)-N-methyl-N-(2-piperidin-1-ylcyclohexyl)acetamide.
| Compound Name | 2-(4-azidophenyl)-N-methyl-N-(2-piperidin-1-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 21328053 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-(4-azidophenyl)-N-methyl-N-(2-piperidin-1-ylcyclohexyl)acetamide |
| SMILES | CN(C(=O)Cc1ccc(N=[N+]=[N-])cc1)C1CCCCC1N1CCCCC1 |
| InChI | InChI=1S/C20H29N5O/c1-24(20(26)15-16-9-11-17(12-10-16)22-23-21)18-7-3-4-8-19(18)25-13-5-2-6-14-25/h9-12,18-19H,2-8,13-15H2,1H3 |
| InChIKey | NOQAEJDWZZOBNO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|