C23H26Cl3N3O3 — CID 10345823
2-(3,4-dichlorophenyl)-N-methyl-N-[(1S,2S)-7-nitro-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;hydrochloride (PubChem CID 10345823) has the molecular formula C23H26Cl3N3O3 and a molecular weight of 498.84 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-[(1S,2S)-7-nitro-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(1S,2S)-7-nitro-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 10345823 |
| Molecular Formula | C23H26Cl3N3O3 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(1S,2S)-7-nitro-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide;hydrochloride |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@H]1c2cc([N+](=O)[O-])ccc2CC[C@@H]1N1CCCC1.Cl |
| InChI | InChI=1S/C23H25Cl2N3O3.ClH/c1-26(22(29)13-15-4-8-19(24)20(25)12-15)23-18-14-17(28(30)31)7-5-16(18)6-9-21(23)27-10-2-3-11-27;/h4-5,7-8,12,14,21,23H,2-3,6,9-11,13H2,1H3;1H/t21-,23-;/m0./s1 |
| InChIKey | BGFRWYAXWSOSOV-IUQUCOCYSA-N |
| XLogP | 5.48 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|