C26H31Cl2N3O2S — CID 14822172
O-[[(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl]] N,N-dimethylcarbamothioate (PubChem CID 14822172) has the molecular formula C26H31Cl2N3O2S and a molecular weight of 520.53 g/mol. Its IUPAC name is O-[[(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl]] N,N-dimethylcarbamothioate.
| Compound Name | O-[[(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 14822172 |
| Molecular Formula | C26H31Cl2N3O2S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | O-[[(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl]] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1cccc2c1CC[C@@H](N1CCCC1)[C@@H]2N(C)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H31Cl2N3O2S/c1-29(2)26(34)33-23-8-6-7-19-18(23)10-12-22(31-13-4-5-14-31)25(19)30(3)24(32)16-17-9-11-20(27)21(28)15-17/h6-9,11,15,22,25H,4-5,10,12-14,16H2,1-3H3/t22-,25-/m1/s1 |
| InChIKey | KKFYIKCMCXIJHJ-RCZVLFRGSA-N |
| XLogP | 5.37 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|