C26H30Cl2N2O3 — CID 14822155
[(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl] propanoate (PubChem CID 14822155) has the molecular formula C26H30Cl2N2O3 and a molecular weight of 489.44 g/mol. Its IUPAC name is [(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl] propanoate.
| Compound Name | [(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl] propanoate |
|---|---|
| PubChem CID | 14822155 |
| Molecular Formula | C26H30Cl2N2O3 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [(5R,6R)-5-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]-6-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl] propanoate |
| SMILES | CCC(=O)Oc1cccc2c1CC[C@@H](N1CCCC1)[C@@H]2N(C)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H30Cl2N2O3/c1-3-25(32)33-23-8-6-7-19-18(23)10-12-22(30-13-4-5-14-30)26(19)29(2)24(31)16-17-9-11-20(27)21(28)15-17/h6-9,11,15,22,26H,3-5,10,12-14,16H2,1-2H3/t22-,26-/m1/s1 |
| InChIKey | XUJLVUCHTATJQH-ATIYNZHBSA-N |
| XLogP | 5.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|