C23H27Cl2N3O — CID 22879441
N-[(1R,2R)-7-amino-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 22879441) has the molecular formula C23H27Cl2N3O and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[(1R,2R)-7-amino-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(1R,2R)-7-amino-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 22879441 |
| Molecular Formula | C23H27Cl2N3O |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[(1R,2R)-7-amino-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@@H]1c2cc(N)ccc2CC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C23H27Cl2N3O/c1-27(22(29)13-15-4-8-19(24)20(25)12-15)23-18-14-17(26)7-5-16(18)6-9-21(23)28-10-2-3-11-28/h4-5,7-8,12,14,21,23H,2-3,6,9-11,13,26H2,1H3/t21-,23-/m1/s1 |
| InChIKey | ZPPGPFXKFNYEMV-FYYLOGMGSA-N |
| XLogP | 4.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|