C16H21N3O3 — CID 94869816
N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 94869816) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 94869816 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H21N3O3/c20-16(11-12-4-6-13(7-5-12)19(21)22)17-14-8-10-18-9-2-1-3-15(14)18/h4-7,14-15H,1-3,8-11H2,(H,17,20)/t14-,15-/m0/s1 |
| InChIKey | ZCLZHUCGMCWEDK-GJZGRUSLSA-N |
| XLogP | 1.88 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|