C27H32N2O — CID 15462301
N-methyl-2,3-diphenyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]cycloprop-2-ene-1-carboxamide (PubChem CID 15462301) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is N-methyl-2,3-diphenyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]cycloprop-2-ene-1-carboxamide.
| Compound Name | N-methyl-2,3-diphenyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]cycloprop-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 15462301 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | N-methyl-2,3-diphenyl-N-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]cycloprop-2-ene-1-carboxamide |
| SMILES | CN(C(=O)C1C(c2ccccc2)=C1c1ccccc1)[C@@H]1CCCC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C27H32N2O/c1-28(22-16-8-9-17-23(22)29-18-10-11-19-29)27(30)26-24(20-12-4-2-5-13-20)25(26)21-14-6-3-7-15-21/h2-7,12-15,22-23,26H,8-11,16-19H2,1H3/t22-,23-/m1/s1 |
| InChIKey | XUMODSIILKPTJT-DHIUTWEWSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|