C18H26ClNO3 — CID 22873287
2-[(1S,2R)-2-morpholin-4-ylcyclohexyl]-2-phenylacetic acid;hydrochloride (PubChem CID 22873287) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is 2-[(1S,2R)-2-morpholin-4-ylcyclohexyl]-2-phenylacetic acid;hydrochloride.
| Compound Name | 2-[(1S,2R)-2-morpholin-4-ylcyclohexyl]-2-phenylacetic acid;hydrochloride |
|---|---|
| PubChem CID | 22873287 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(1S,2R)-2-morpholin-4-ylcyclohexyl]-2-phenylacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)C(c1ccccc1)[C@@H]1CCCC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C18H25NO3.ClH/c20-18(21)17(14-6-2-1-3-7-14)15-8-4-5-9-16(15)19-10-12-22-13-11-19;/h1-3,6-7,15-17H,4-5,8-13H2,(H,20,21);1H/t15-,16-,17?;/m1./s1 |
| InChIKey | VFBYDRWKCGNIAT-OASRYDDSSA-N |
| XLogP | 3.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |