C15H23NO3 — CID 102415614
(R)-furan-2-yl-[(1R,2R)-2-morpholin-4-ylcyclohexyl]methanol (PubChem CID 102415614) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (R)-furan-2-yl-[(1R,2R)-2-morpholin-4-ylcyclohexyl]methanol.
| Compound Name | (R)-furan-2-yl-[(1R,2R)-2-morpholin-4-ylcyclohexyl]methanol |
|---|---|
| PubChem CID | 102415614 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (R)-furan-2-yl-[(1R,2R)-2-morpholin-4-ylcyclohexyl]methanol |
| SMILES | O[C@@H](c1ccco1)[C@@H]1CCCC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C15H23NO3/c17-15(14-6-3-9-19-14)12-4-1-2-5-13(12)16-7-10-18-11-8-16/h3,6,9,12-13,15,17H,1-2,4-5,7-8,10-11H2/t12-,13-,15-/m1/s1 |
| InChIKey | MHONPZRIXMRHNS-UMVBOHGHSA-N |
| XLogP | 2.20 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |