C17H23NO2 — CID 125474477
[(1R,2S)-2-morpholin-4-ylcyclohexyl]-phenylmethanone (PubChem CID 125474477) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is [(1R,2S)-2-morpholin-4-ylcyclohexyl]-phenylmethanone.
| Compound Name | [(1R,2S)-2-morpholin-4-ylcyclohexyl]-phenylmethanone |
|---|---|
| PubChem CID | 125474477 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [(1R,2S)-2-morpholin-4-ylcyclohexyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CCCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C17H23NO2/c19-17(14-6-2-1-3-7-14)15-8-4-5-9-16(15)18-10-12-20-13-11-18/h1-3,6-7,15-16H,4-5,8-13H2/t15-,16+/m1/s1 |
| InChIKey | ZFPMXCFWZIVCBU-CVEARBPZSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |