C15H26N2O2 — CID 125474305
morpholin-4-yl-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone (PubChem CID 125474305) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is morpholin-4-yl-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone.
| Compound Name | morpholin-4-yl-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone |
|---|---|
| PubChem CID | 125474305 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | morpholin-4-yl-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone |
| SMILES | O=C([C@@H]1CCCC[C@@H]1N1CCCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H26N2O2/c18-15(17-9-11-19-12-10-17)13-5-1-2-6-14(13)16-7-3-4-8-16/h13-14H,1-12H2/t13-,14+/m1/s1 |
| InChIKey | QCXNOLDVXAACTI-KGLIPLIRSA-N |
| XLogP | 1.50 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |