C17H22ClNO — CID 125473639
(4-chlorophenyl)-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone (PubChem CID 125473639) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is (4-chlorophenyl)-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone.
| Compound Name | (4-chlorophenyl)-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone |
|---|---|
| PubChem CID | 125473639 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (4-chlorophenyl)-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)[C@@H]1CCCC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C17H22ClNO/c18-14-9-7-13(8-10-14)17(20)15-5-1-2-6-16(15)19-11-3-4-12-19/h7-10,15-16H,1-6,11-12H2/t15-,16+/m1/s1 |
| InChIKey | NYPOXWYRZIEJON-CVEARBPZSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |