C13H20O2 — CID 107192265
(2,2-dimethylcyclohexyl)-(furan-2-yl)methanol (PubChem CID 107192265) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (2,2-dimethylcyclohexyl)-(furan-2-yl)methanol.
| Compound Name | (2,2-dimethylcyclohexyl)-(furan-2-yl)methanol |
|---|---|
| PubChem CID | 107192265 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (2,2-dimethylcyclohexyl)-(furan-2-yl)methanol |
| SMILES | CC1(C)CCCCC1C(O)c1ccco1 |
| InChI | InChI=1S/C13H20O2/c1-13(2)8-4-3-6-10(13)12(14)11-7-5-9-15-11/h5,7,9-10,12,14H,3-4,6,8H2,1-2H3 |
| InChIKey | OYJDQAVTSXLDKL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |