C16H22Cl2O — CID 107192076
2-(2,6-dichlorophenyl)-1-(2,2-dimethylcyclohexyl)ethanol (PubChem CID 107192076) has the molecular formula C16H22Cl2O and a molecular weight of 301.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(2,2-dimethylcyclohexyl)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(2,2-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 107192076 |
| Molecular Formula | C16H22Cl2O |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(2,2-dimethylcyclohexyl)ethanol |
| SMILES | CC1(C)CCCCC1C(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H22Cl2O/c1-16(2)9-4-3-6-12(16)15(19)10-11-13(17)7-5-8-14(11)18/h5,7-8,12,15,19H,3-4,6,9-10H2,1-2H3 |
| InChIKey | FIPSORQUDNANCR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |