C18H26N2O — CID 107192548
1-(2,2-dimethylcyclohexyl)-2-(1-methylindazol-3-yl)ethanol (PubChem CID 107192548) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclohexyl)-2-(1-methylindazol-3-yl)ethanol.
| Compound Name | 1-(2,2-dimethylcyclohexyl)-2-(1-methylindazol-3-yl)ethanol |
|---|---|
| PubChem CID | 107192548 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-(2,2-dimethylcyclohexyl)-2-(1-methylindazol-3-yl)ethanol |
| SMILES | Cn1nc(CC(O)C2CCCCC2(C)C)c2ccccc21 |
| InChI | InChI=1S/C18H26N2O/c1-18(2)11-7-6-9-14(18)17(21)12-15-13-8-4-5-10-16(13)20(3)19-15/h4-5,8,10,14,17,21H,6-7,9,11-12H2,1-3H3 |
| InChIKey | JWBTYRYFWDVXGU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |