C16H26OS — CID 107192144
1-(2,2-dimethylcyclohexyl)-2-(5-ethylthiophen-2-yl)ethanol (PubChem CID 107192144) has the molecular formula C16H26OS and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclohexyl)-2-(5-ethylthiophen-2-yl)ethanol.
| Compound Name | 1-(2,2-dimethylcyclohexyl)-2-(5-ethylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 107192144 |
| Molecular Formula | C16H26OS |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(2,2-dimethylcyclohexyl)-2-(5-ethylthiophen-2-yl)ethanol |
| SMILES | CCc1ccc(CC(O)C2CCCCC2(C)C)s1 |
| InChI | InChI=1S/C16H26OS/c1-4-12-8-9-13(18-12)11-15(17)14-7-5-6-10-16(14,2)3/h8-9,14-15,17H,4-7,10-11H2,1-3H3 |
| InChIKey | NSBJLDHOHXEYIL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |