C15H24OS2 — CID 65139689
1-cyclohexylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol (PubChem CID 65139689) has the molecular formula C15H24OS2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1-cyclohexylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol.
| Compound Name | 1-cyclohexylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 65139689 |
| Molecular Formula | C15H24OS2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-cyclohexylsulfanyl-3-(5-ethylthiophen-2-yl)propan-2-ol |
| SMILES | CCc1ccc(CC(O)CSC2CCCCC2)s1 |
| InChI | InChI=1S/C15H24OS2/c1-2-13-8-9-15(18-13)10-12(16)11-17-14-6-4-3-5-7-14/h8-9,12,14,16H,2-7,10-11H2,1H3 |
| InChIKey | JTRVJTRSEZPKBP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |