C14H22ClNS2 — CID 65139957
1-(5-chlorothiophen-2-yl)-3-cyclohexylsulfanyl-N-methylpropan-2-amine (PubChem CID 65139957) has the molecular formula C14H22ClNS2 and a molecular weight of 303.92 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-cyclohexylsulfanyl-N-methylpropan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-cyclohexylsulfanyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 65139957 |
| Molecular Formula | C14H22ClNS2 |
| Molecular Weight | 303.92 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-cyclohexylsulfanyl-N-methylpropan-2-amine |
| SMILES | CNC(CSC1CCCCC1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H22ClNS2/c1-16-11(9-13-7-8-14(15)18-13)10-17-12-5-3-2-4-6-12/h7-8,11-12,16H,2-6,9-10H2,1H3 |
| InChIKey | GGBIEVBASKAZGK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |