C17H26FNS — CID 105373963
1-cyclohexylsulfanyl-3-(5-fluoro-2-methylphenyl)-N-methylpropan-2-amine (PubChem CID 105373963) has the molecular formula C17H26FNS and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-cyclohexylsulfanyl-3-(5-fluoro-2-methylphenyl)-N-methylpropan-2-amine.
| Compound Name | 1-cyclohexylsulfanyl-3-(5-fluoro-2-methylphenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 105373963 |
| Molecular Formula | C17H26FNS |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 1-cyclohexylsulfanyl-3-(5-fluoro-2-methylphenyl)-N-methylpropan-2-amine |
| SMILES | CNC(CSC1CCCCC1)Cc1cc(F)ccc1C |
| InChI | InChI=1S/C17H26FNS/c1-13-8-9-15(18)10-14(13)11-16(19-2)12-20-17-6-4-3-5-7-17/h8-10,16-17,19H,3-7,11-12H2,1-2H3 |
| InChIKey | DOQUZCNBKQDQEF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |