C20H32O — CID 107192147
2-(4-tert-butylphenyl)-1-(2,2-dimethylcyclohexyl)ethanol (PubChem CID 107192147) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-(2,2-dimethylcyclohexyl)ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-1-(2,2-dimethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 107192147 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-(2,2-dimethylcyclohexyl)ethanol |
| SMILES | CC(C)(C)c1ccc(CC(O)C2CCCCC2(C)C)cc1 |
| InChI | InChI=1S/C20H32O/c1-19(2,3)16-11-9-15(10-12-16)14-18(21)17-8-6-7-13-20(17,4)5/h9-12,17-18,21H,6-8,13-14H2,1-5H3 |
| InChIKey | ZEKQFOXTTHJFST-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |