C18H29N — CID 107177014
(4-tert-butylphenyl)-(2,2-dimethylcyclopentyl)methanamine (PubChem CID 107177014) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(2,2-dimethylcyclopentyl)methanamine.
| Compound Name | (4-tert-butylphenyl)-(2,2-dimethylcyclopentyl)methanamine |
|---|---|
| PubChem CID | 107177014 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (4-tert-butylphenyl)-(2,2-dimethylcyclopentyl)methanamine |
| SMILES | CC(C)(C)c1ccc(C(N)C2CCCC2(C)C)cc1 |
| InChI | InChI=1S/C18H29N/c1-17(2,3)14-10-8-13(9-11-14)16(19)15-7-6-12-18(15,4)5/h8-11,15-16H,6-7,12,19H2,1-5H3 |
| InChIKey | OYZXNGFGKJAWEO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |